Fungicide Pesticide Hymexazol SL (300g/l SL, 360g/l SL)
Description: A systemic fungicide used to control soil-borne diseases caused byFusaruim, Aphanomyces and Pythium spp.
Example pests controlled: Fusarium crown rot; Root rot; Stem rot
Example applications: Rice; Sugarbeet; Fodder beet; Vegetables; Tomatoes; Ornamentals
Chemical structure:
General status:
Description: A systemic fungicide used to control soil-borne diseases caused byFusaruim, Aphanomyces and Pythium spp.
Example pests controlled: Fusarium crown rot; Root rot; Stem rot
Example applications: Rice; Sugarbeet; Fodder beet; Vegetables; Tomatoes; Ornamentals
Chemical structure:
| Isomerism | None |
| Chemical formula | C4H5NO2 |
| Canonical SMILES | CC1=CC(=O)NO1 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | KGVPNLBXJKTABS-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C4H5NO2/c1-3-2-4(6)5-7-3/h2H,1H3,(H,5,6) |
General status:
| Pesticide type | Fungicide |
| Substance group | Oxazole |
| Minimum active substance purity | 985 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Systemic, inhibits fungal growth by inhibiting nucleic acid synthesis (DNA / RNA synthesis). |
| CAS RN | 10004-44-1 |
| EC number | 233-000-6 |
| CIPAC number | 528 |
| US EPA chemical code | - |
| PubChem CID | 24781 |
| Molecular mass (g mol-1) | 99.15 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 5-methylisoxazol-3-ol |
| CAS name | 5-methyl-3(2H)-isoxazolone |